C17H10N4O3S — CID 5301645
3-(2-nitrophenyl)-7-phenyl-[1,2,4]triazolo[3,4-b][1,3]thiazin-5-one (PubChem CID 5301645) has the molecular formula C17H10N4O3S and a molecular weight of 350.36 g/mol. Its IUPAC name is 3-(2-nitrophenyl)-7-phenyl-[1,2,4]triazolo[3,4-b][1,3]thiazin-5-one.
| Compound Name | 3-(2-nitrophenyl)-7-phenyl-[1,2,4]triazolo[3,4-b][1,3]thiazin-5-one |
|---|---|
| PubChem CID | 5301645 |
| Molecular Formula | C17H10N4O3S |
| Molecular Weight | 350.36 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | 3-(2-nitrophenyl)-7-phenyl-[1,2,4]triazolo[3,4-b][1,3]thiazin-5-one |
| SMILES | O=c1cc(-c2ccccc2)sc2nnc(-c3ccccc3[N+](=O)[O-])n12 |
| InChI | InChI=1S/C17H10N4O3S/c22-15-10-14(11-6-2-1-3-7-11)25-17-19-18-16(20(15)17)12-8-4-5-9-13(12)21(23)24/h1-10H |
| InChIKey | FAIOFHDDUKGZPG-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 90.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.36 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|