C11H8F3IN2O2 — CID 71741988
ethyl 6-iodo-8-(trifluoromethyl)imidazo[1,2-a]pyridine-2-carboxylate (PubChem CID 71741988) has the molecular formula C11H8F3IN2O2 and a molecular weight of 384.10 g/mol. Its IUPAC name is ethyl 6-iodo-8-(trifluoromethyl)imidazo[1,2-a]pyridine-2-carboxylate.
| Compound Name | ethyl 6-iodo-8-(trifluoromethyl)imidazo[1,2-a]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 71741988 |
| Molecular Formula | C11H8F3IN2O2 |
| Molecular Weight | 384.10 g/mol |
| Exact Mass | 383.96 |
| IUPAC Name | ethyl 6-iodo-8-(trifluoromethyl)imidazo[1,2-a]pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1cn2cc(I)cc(C(F)(F)F)c2n1 |
| InChI | InChI=1S/C11H8F3IN2O2/c1-2-19-10(18)8-5-17-4-6(15)3-7(9(17)16-8)11(12,13)14/h3-5H,2H2,1H3 |
| InChIKey | FMSXOZWTVWZJMG-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.10 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|