C15H17F3N2O — CID 117187667
4-methyl-1-propan-2-yl-2-[[3-(trifluoromethyl)phenoxy]methyl]imidazole (PubChem CID 117187667) has the molecular formula C15H17F3N2O and a molecular weight of 298.31 g/mol. Its IUPAC name is 4-methyl-1-propan-2-yl-2-[[3-(trifluoromethyl)phenoxy]methyl]imidazole.
| Compound Name | 4-methyl-1-propan-2-yl-2-[[3-(trifluoromethyl)phenoxy]methyl]imidazole |
|---|---|
| PubChem CID | 117187667 |
| Molecular Formula | C15H17F3N2O |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 4-methyl-1-propan-2-yl-2-[[3-(trifluoromethyl)phenoxy]methyl]imidazole |
| SMILES | Cc1cn(C(C)C)c(COc2cccc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C15H17F3N2O/c1-10(2)20-8-11(3)19-14(20)9-21-13-6-4-5-12(7-13)15(16,17)18/h4-8,10H,9H2,1-3H3 |
| InChIKey | YKWHRXIGNORCSG-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |