C13H13F3N2O — CID 117188379
1,5-dimethyl-2-[[3-(trifluoromethyl)phenoxy]methyl]imidazole (PubChem CID 117188379) has the molecular formula C13H13F3N2O and a molecular weight of 270.25 g/mol. Its IUPAC name is 1,5-dimethyl-2-[[3-(trifluoromethyl)phenoxy]methyl]imidazole.
| Compound Name | 1,5-dimethyl-2-[[3-(trifluoromethyl)phenoxy]methyl]imidazole |
|---|---|
| PubChem CID | 117188379 |
| Molecular Formula | C13H13F3N2O |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 1,5-dimethyl-2-[[3-(trifluoromethyl)phenoxy]methyl]imidazole |
| SMILES | Cc1cnc(COc2cccc(C(F)(F)F)c2)n1C |
| InChI | InChI=1S/C13H13F3N2O/c1-9-7-17-12(18(9)2)8-19-11-5-3-4-10(6-11)13(14,15)16/h3-7H,8H2,1-2H3 |
| InChIKey | TXMSNVXUPIPPJR-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |