C17H20N4O9 — CID 11718782
(2S)-2-[[2-[methyl-[2-[methyl-(4-nitrobenzoyl)amino]acetyl]amino]acetyl]amino]butanedioic acid (PubChem CID 11718782) has the molecular formula C17H20N4O9 and a molecular weight of 424.37 g/mol. Its IUPAC name is (2S)-2-[[2-[methyl-[2-[methyl-(4-nitrobenzoyl)amino]acetyl]amino]acetyl]amino]butanedioic acid.
| Compound Name | (2S)-2-[[2-[methyl-[2-[methyl-(4-nitrobenzoyl)amino]acetyl]amino]acetyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 11718782 |
| Molecular Formula | C17H20N4O9 |
| Molecular Weight | 424.37 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | (2S)-2-[[2-[methyl-[2-[methyl-(4-nitrobenzoyl)amino]acetyl]amino]acetyl]amino]butanedioic acid |
| SMILES | CN(CC(=O)N[C@@H](CC(=O)O)C(=O)O)C(=O)CN(C)C(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H20N4O9/c1-19(8-13(22)18-12(17(27)28)7-15(24)25)14(23)9-20(2)16(26)10-3-5-11(6-4-10)21(29)30/h3-6,12H,7-9H2,1-2H3,(H,18,22)(H,24,25)(H,27,28)/t12-/m0/s1 |
| InChIKey | GADOCKPCOJKWKM-LBPRGKRZSA-N |
| XLogP | -0.83 |
| TPSA | 187.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.37 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|