C10H9FN2O3S — CID 117188080
2-[(2-fluorophenoxy)methyl]-1,1-dioxo-1,3-thiazol-5-amine (PubChem CID 117188080) has the molecular formula C10H9FN2O3S and a molecular weight of 256.26 g/mol. Its IUPAC name is 2-[(2-fluorophenoxy)methyl]-1,1-dioxo-1,3-thiazol-5-amine.
| Compound Name | 2-[(2-fluorophenoxy)methyl]-1,1-dioxo-1,3-thiazol-5-amine |
|---|---|
| PubChem CID | 117188080 |
| Molecular Formula | C10H9FN2O3S |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.03 |
| IUPAC Name | 2-[(2-fluorophenoxy)methyl]-1,1-dioxo-1,3-thiazol-5-amine |
| SMILES | NC1=CN=C(COc2ccccc2F)S1(=O)=O |
| InChI | InChI=1S/C10H9FN2O3S/c11-7-3-1-2-4-8(7)16-6-10-13-5-9(12)17(10,14)15/h1-5H,6,12H2 |
| InChIKey | MSHQOWKQTRZMMV-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |