C10H7F3N2O2 — CID 117188911
2-[4-(trifluoromethyl)phenoxy]-1,3-oxazol-4-amine (PubChem CID 117188911) has the molecular formula C10H7F3N2O2 and a molecular weight of 244.17 g/mol. Its IUPAC name is 2-[4-(trifluoromethyl)phenoxy]-1,3-oxazol-4-amine.
| Compound Name | 2-[4-(trifluoromethyl)phenoxy]-1,3-oxazol-4-amine |
|---|---|
| PubChem CID | 117188911 |
| Molecular Formula | C10H7F3N2O2 |
| Molecular Weight | 244.17 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | 2-[4-(trifluoromethyl)phenoxy]-1,3-oxazol-4-amine |
| SMILES | Nc1coc(Oc2ccc(C(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C10H7F3N2O2/c11-10(12,13)6-1-3-7(4-2-6)17-9-15-8(14)5-16-9/h1-5H,14H2 |
| InChIKey | DKKZOBKWGGBGGL-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.17 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |