C24H31FN2O4 — CID 11718945
(2S)-2-ethoxy-3-[4-[4-fluoro-3-[methyl(pentylcarbamoyl)amino]phenyl]phenyl]propanoic acid (PubChem CID 11718945) has the molecular formula C24H31FN2O4 and a molecular weight of 430.52 g/mol. Its IUPAC name is (2S)-2-ethoxy-3-[4-[4-fluoro-3-[methyl(pentylcarbamoyl)amino]phenyl]phenyl]propanoic acid.
| Compound Name | (2S)-2-ethoxy-3-[4-[4-fluoro-3-[methyl(pentylcarbamoyl)amino]phenyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 11718945 |
| Molecular Formula | C24H31FN2O4 |
| Molecular Weight | 430.52 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | (2S)-2-ethoxy-3-[4-[4-fluoro-3-[methyl(pentylcarbamoyl)amino]phenyl]phenyl]propanoic acid |
| SMILES | CCCCCNC(=O)N(C)c1cc(-c2ccc(C[C@H](OCC)C(=O)O)cc2)ccc1F |
| InChI | InChI=1S/C24H31FN2O4/c1-4-6-7-14-26-24(30)27(3)21-16-19(12-13-20(21)25)18-10-8-17(9-11-18)15-22(23(28)29)31-5-2/h8-13,16,22H,4-7,14-15H2,1-3H3,(H,26,30)(H,28,29)/t22-/m0/s1 |
| InChIKey | NYBXQARXKIYDMW-QFIPXVFZSA-N |
| XLogP | 4.86 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.52 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|