C8H15N3 — CID 117189633
1-ethyl-N,N,4-trimethylimidazol-2-amine (PubChem CID 117189633) has the molecular formula C8H15N3 and a molecular weight of 153.23 g/mol. Its IUPAC name is 1-ethyl-N,N,4-trimethylimidazol-2-amine.
| Compound Name | 1-ethyl-N,N,4-trimethylimidazol-2-amine |
|---|---|
| PubChem CID | 117189633 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | 1-ethyl-N,N,4-trimethylimidazol-2-amine |
| SMILES | CCn1cc(C)nc1N(C)C |
| InChI | InChI=1S/C8H15N3/c1-5-11-6-7(2)9-8(11)10(3)4/h6H,5H2,1-4H3 |
| InChIKey | HREDXGPTCYWJDE-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |