C12H13BrClN3 — CID 106577587
N-(2-bromo-4-chlorophenyl)-1-ethyl-4-methylimidazol-2-amine (PubChem CID 106577587) has the molecular formula C12H13BrClN3 and a molecular weight of 314.61 g/mol. Its IUPAC name is N-(2-bromo-4-chlorophenyl)-1-ethyl-4-methylimidazol-2-amine.
| Compound Name | N-(2-bromo-4-chlorophenyl)-1-ethyl-4-methylimidazol-2-amine |
|---|---|
| PubChem CID | 106577587 |
| Molecular Formula | C12H13BrClN3 |
| Molecular Weight | 314.61 g/mol |
| Exact Mass | 313.00 |
| IUPAC Name | N-(2-bromo-4-chlorophenyl)-1-ethyl-4-methylimidazol-2-amine |
| SMILES | CCn1cc(C)nc1Nc1ccc(Cl)cc1Br |
| InChI | InChI=1S/C12H13BrClN3/c1-3-17-7-8(2)15-12(17)16-11-5-4-9(14)6-10(11)13/h4-7H,3H2,1-2H3,(H,15,16) |
| InChIKey | LKNZZLIJCUJTRH-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.61 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |