C12H13Cl2N3 — CID 106560336
N-(2,3-dichlorophenyl)-1-ethyl-4-methylimidazol-2-amine (PubChem CID 106560336) has the molecular formula C12H13Cl2N3 and a molecular weight of 270.16 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-1-ethyl-4-methylimidazol-2-amine.
| Compound Name | N-(2,3-dichlorophenyl)-1-ethyl-4-methylimidazol-2-amine |
|---|---|
| PubChem CID | 106560336 |
| Molecular Formula | C12H13Cl2N3 |
| Molecular Weight | 270.16 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | N-(2,3-dichlorophenyl)-1-ethyl-4-methylimidazol-2-amine |
| SMILES | CCn1cc(C)nc1Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C12H13Cl2N3/c1-3-17-7-8(2)15-12(17)16-10-6-4-5-9(13)11(10)14/h4-7H,3H2,1-2H3,(H,15,16) |
| InChIKey | KOQXWQBAZSEQFI-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.16 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |