C10H15N5 — CID 106562971
1-ethyl-4-methyl-N-(1-methylpyrazol-3-yl)imidazol-2-amine (PubChem CID 106562971) has the molecular formula C10H15N5 and a molecular weight of 205.26 g/mol. Its IUPAC name is 1-ethyl-4-methyl-N-(1-methylpyrazol-3-yl)imidazol-2-amine.
| Compound Name | 1-ethyl-4-methyl-N-(1-methylpyrazol-3-yl)imidazol-2-amine |
|---|---|
| PubChem CID | 106562971 |
| Molecular Formula | C10H15N5 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | 1-ethyl-4-methyl-N-(1-methylpyrazol-3-yl)imidazol-2-amine |
| SMILES | CCn1cc(C)nc1Nc1ccn(C)n1 |
| InChI | InChI=1S/C10H15N5/c1-4-15-7-8(2)11-10(15)12-9-5-6-14(3)13-9/h5-7H,4H2,1-3H3,(H,11,12,13) |
| InChIKey | GYKURIFYAAMOBY-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 47.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |