C9H7ClN2O3S — CID 117190258
2-(3-chlorophenoxy)-1,1-dioxo-1,3-thiazol-5-amine (PubChem CID 117190258) has the molecular formula C9H7ClN2O3S and a molecular weight of 258.69 g/mol. Its IUPAC name is 2-(3-chlorophenoxy)-1,1-dioxo-1,3-thiazol-5-amine.
| Compound Name | 2-(3-chlorophenoxy)-1,1-dioxo-1,3-thiazol-5-amine |
|---|---|
| PubChem CID | 117190258 |
| Molecular Formula | C9H7ClN2O3S |
| Molecular Weight | 258.69 g/mol |
| Exact Mass | 257.99 |
| IUPAC Name | 2-(3-chlorophenoxy)-1,1-dioxo-1,3-thiazol-5-amine |
| SMILES | NC1=CN=C(Oc2cccc(Cl)c2)S1(=O)=O |
| InChI | InChI=1S/C9H7ClN2O3S/c10-6-2-1-3-7(4-6)15-9-12-5-8(11)16(9,13)14/h1-5H,11H2 |
| InChIKey | DXZFFQUEVYBVOK-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.69 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |