C8H11BrN2OS — CID 117191298
4-[(2-bromo-1,3-thiazol-4-yl)methyl]morpholine (PubChem CID 117191298) has the molecular formula C8H11BrN2OS and a molecular weight of 263.16 g/mol. Its IUPAC name is 4-[(2-bromo-1,3-thiazol-4-yl)methyl]morpholine.
| Compound Name | 4-[(2-bromo-1,3-thiazol-4-yl)methyl]morpholine |
|---|---|
| PubChem CID | 117191298 |
| Molecular Formula | C8H11BrN2OS |
| Molecular Weight | 263.16 g/mol |
| Exact Mass | 261.98 |
| IUPAC Name | 4-[(2-bromo-1,3-thiazol-4-yl)methyl]morpholine |
| SMILES | Brc1nc(CN2CCOCC2)cs1 |
| InChI | InChI=1S/C8H11BrN2OS/c9-8-10-7(6-13-8)5-11-1-3-12-4-2-11/h6H,1-5H2 |
| InChIKey | OFNYBEGUGXNOJQ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.16 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |