C9H16N4 — CID 117191734
4-[(cyclopropylamino)methyl]-1-ethylimidazol-2-amine (PubChem CID 117191734) has the molecular formula C9H16N4 and a molecular weight of 180.25 g/mol. Its IUPAC name is 4-[(cyclopropylamino)methyl]-1-ethylimidazol-2-amine.
| Compound Name | 4-[(cyclopropylamino)methyl]-1-ethylimidazol-2-amine |
|---|---|
| PubChem CID | 117191734 |
| Molecular Formula | C9H16N4 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | 4-[(cyclopropylamino)methyl]-1-ethylimidazol-2-amine |
| SMILES | CCn1cc(CNC2CC2)nc1N |
| InChI | InChI=1S/C9H16N4/c1-2-13-6-8(12-9(13)10)5-11-7-3-4-7/h6-7,11H,2-5H2,1H3,(H2,10,12) |
| InChIKey | JXWZPJSRWRBCSX-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |