C12H16N4 — CID 117256043
2-[(cyclobutylamino)methyl]imidazo[1,2-a]pyridin-6-amine (PubChem CID 117256043) has the molecular formula C12H16N4 and a molecular weight of 216.29 g/mol. Its IUPAC name is 2-[(cyclobutylamino)methyl]imidazo[1,2-a]pyridin-6-amine.
| Compound Name | 2-[(cyclobutylamino)methyl]imidazo[1,2-a]pyridin-6-amine |
|---|---|
| PubChem CID | 117256043 |
| Molecular Formula | C12H16N4 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | 2-[(cyclobutylamino)methyl]imidazo[1,2-a]pyridin-6-amine |
| SMILES | Nc1ccc2nc(CNC3CCC3)cn2c1 |
| InChI | InChI=1S/C12H16N4/c13-9-4-5-12-15-11(8-16(12)7-9)6-14-10-2-1-3-10/h4-5,7-8,10,14H,1-3,6,13H2 |
| InChIKey | MTXJMOMBAQATGY-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 55.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |