C11H11NO4S — CID 117192456
2-[(2-methyl-1,1-dioxo-1,3-thiazol-5-yl)methoxy]phenol (PubChem CID 117192456) has the molecular formula C11H11NO4S and a molecular weight of 253.28 g/mol. Its IUPAC name is 2-[(2-methyl-1,1-dioxo-1,3-thiazol-5-yl)methoxy]phenol.
| Compound Name | 2-[(2-methyl-1,1-dioxo-1,3-thiazol-5-yl)methoxy]phenol |
|---|---|
| PubChem CID | 117192456 |
| Molecular Formula | C11H11NO4S |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.04 |
| IUPAC Name | 2-[(2-methyl-1,1-dioxo-1,3-thiazol-5-yl)methoxy]phenol |
| SMILES | CC1=NC=C(COc2ccccc2O)S1(=O)=O |
| InChI | InChI=1S/C11H11NO4S/c1-8-12-6-9(17(8,14)15)7-16-11-5-3-2-4-10(11)13/h2-6,13H,7H2,1H3 |
| InChIKey | ZLSTYUOLFIGZFE-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |