C9H6ClNO4S — CID 117260259
2-[(5-chloro-1,1-dioxo-1,3-thiazol-2-yl)oxy]phenol (PubChem CID 117260259) has the molecular formula C9H6ClNO4S and a molecular weight of 259.67 g/mol. Its IUPAC name is 2-[(5-chloro-1,1-dioxo-1,3-thiazol-2-yl)oxy]phenol.
| Compound Name | 2-[(5-chloro-1,1-dioxo-1,3-thiazol-2-yl)oxy]phenol |
|---|---|
| PubChem CID | 117260259 |
| Molecular Formula | C9H6ClNO4S |
| Molecular Weight | 259.67 g/mol |
| Exact Mass | 258.97 |
| IUPAC Name | 2-[(5-chloro-1,1-dioxo-1,3-thiazol-2-yl)oxy]phenol |
| SMILES | O=S1(=O)C(Cl)=CN=C1Oc1ccccc1O |
| InChI | InChI=1S/C9H6ClNO4S/c10-8-5-11-9(16(8,13)14)15-7-4-2-1-3-6(7)12/h1-5,12H |
| InChIKey | RXBSLSMIYLDAON-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.67 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |