4-chloro-2-(2-hydroxyphenoxy)-1,3-thiazole-5-carboxylic acid

C10H6ClNO4S — CID 117258721

IUPAC4-chloro-2-(2-hydroxyphenoxy)-1,3-thiazole-5-carboxylic acid
SMILESO=C(O)c1sc(Oc2ccccc2O)nc1Cl
InChIInChI=1S/C10H6ClNO4S/c11-8-7(9(14)15)17-10(12-8)16-6-4-2-1-3-5(6)13/h1-4,13H,(H,14,15)
InChIKeyHXZFJWBMHLTFOE-UHFFFAOYSA-N
MW271.68 g/mol
LogP2.99
Rot. Bonds3

About 4-chloro-2-(2-hydroxyphenoxy)-1,3-thiazole-5-carboxylic acid

4-chloro-2-(2-hydroxyphenoxy)-1,3-thiazole-5-carboxylic acid (PubChem CID 117258721) has the molecular formula C10H6ClNO4S and a molecular weight of 271.68 g/mol. Its IUPAC name is 4-chloro-2-(2-hydroxyphenoxy)-1,3-thiazole-5-carboxylic acid.

Molecular Properties

Compound Name4-chloro-2-(2-hydroxyphenoxy)-1,3-thiazole-5-carboxylic acid
PubChem CID117258721
Molecular FormulaC10H6ClNO4S
Molecular Weight271.68 g/mol
Exact Mass270.97
IUPAC Name4-chloro-2-(2-hydroxyphenoxy)-1,3-thiazole-5-carboxylic acid
SMILESO=C(O)c1sc(Oc2ccccc2O)nc1Cl
InChIInChI=1S/C10H6ClNO4S/c11-8-7(9(14)15)17-10(12-8)16-6-4-2-1-3-5(6)13/h1-4,13H,(H,14,15)
InChIKeyHXZFJWBMHLTFOE-UHFFFAOYSA-N
XLogP2.99
TPSA79.65 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500271.68
LogP ≤ 52.99
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 4-chloro-2-(2-hydroxyphenoxy)-1,3-thiazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-chloro-2-(2-hydroxyphenoxy)-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 4-chloro-2-(2-hydroxyphenoxy)-1,3-thiazole-5-carboxylic acid (CID 117258721) is 4-chloro-2-(2-hydroxyphenoxy)-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 4-chloro-2-(2-hydroxyphenoxy)-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 4-chloro-2-(2-hydroxyphenoxy)-1,3-thiazole-5-carboxylic acid is O=C(O)c1sc(Oc2ccccc2O)nc1Cl.
What is the InChIKey of 4-chloro-2-(2-hydroxyphenoxy)-1,3-thiazole-5-carboxylic acid?
The InChIKey is HXZFJWBMHLTFOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6ClNO4S/c11-8-7(9(14)15)17-10(12-8)16-6-4-2-1-3-5(6)13/h1-4,13H,(H,14,15).
What are the key properties of 4-chloro-2-(2-hydroxyphenoxy)-1,3-thiazole-5-carboxylic acid?
4-chloro-2-(2-hydroxyphenoxy)-1,3-thiazole-5-carboxylic acid has a molecular weight of 271.68 g/mol, XLogP of 2.99, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-(2-hydroxyphenoxy)-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 117258721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).