C11H7ClN2O4S — CID 80692779
2-(4-carbamoylphenoxy)-4-chloro-1,3-thiazole-5-carboxylic acid (PubChem CID 80692779) has the molecular formula C11H7ClN2O4S and a molecular weight of 298.71 g/mol. Its IUPAC name is 2-(4-carbamoylphenoxy)-4-chloro-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-(4-carbamoylphenoxy)-4-chloro-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 80692779 |
| Molecular Formula | C11H7ClN2O4S |
| Molecular Weight | 298.71 g/mol |
| Exact Mass | 297.98 |
| IUPAC Name | 2-(4-carbamoylphenoxy)-4-chloro-1,3-thiazole-5-carboxylic acid |
| SMILES | NC(=O)c1ccc(Oc2nc(Cl)c(C(=O)O)s2)cc1 |
| InChI | InChI=1S/C11H7ClN2O4S/c12-8-7(10(16)17)19-11(14-8)18-6-3-1-5(2-4-6)9(13)15/h1-4H,(H2,13,15)(H,16,17) |
| InChIKey | JYFPXZJPWBGXEG-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 102.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.71 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |