C12H12N2O2 — CID 60868956
2-(4,6-dimethylpyrimidin-2-yl)oxyphenol (PubChem CID 60868956) has the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. Its IUPAC name is 2-(4,6-dimethylpyrimidin-2-yl)oxyphenol.
| Compound Name | 2-(4,6-dimethylpyrimidin-2-yl)oxyphenol |
|---|---|
| PubChem CID | 60868956 |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 2-(4,6-dimethylpyrimidin-2-yl)oxyphenol |
| SMILES | Cc1cc(C)nc(Oc2ccccc2O)n1 |
| InChI | InChI=1S/C12H12N2O2/c1-8-7-9(2)14-12(13-8)16-11-6-4-3-5-10(11)15/h3-7,15H,1-2H3 |
| InChIKey | DCSHUDSNLKRKRP-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |