C12H11FN2O — CID 671376
2-(2-fluorophenoxy)-4,6-dimethylpyrimidine (PubChem CID 671376) has the molecular formula C12H11FN2O and a molecular weight of 218.23 g/mol. Its IUPAC name is 2-(2-fluorophenoxy)-4,6-dimethylpyrimidine.
| Compound Name | 2-(2-fluorophenoxy)-4,6-dimethylpyrimidine |
|---|---|
| PubChem CID | 671376 |
| Molecular Formula | C12H11FN2O |
| Molecular Weight | 218.23 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 2-(2-fluorophenoxy)-4,6-dimethylpyrimidine |
| SMILES | Cc1cc(C)nc(Oc2ccccc2F)n1 |
| InChI | InChI=1S/C12H11FN2O/c1-8-7-9(2)15-12(14-8)16-11-6-4-3-5-10(11)13/h3-7H,1-2H3 |
| InChIKey | FIMJTBILBQPIBS-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.23 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |