C13H14N4O3 — CID 136907097
N'-hydroxy-2-(2-methoxyphenoxy)-6-methylpyrimidine-4-carboximidamide (PubChem CID 136907097) has the molecular formula C13H14N4O3 and a molecular weight of 274.28 g/mol. Its IUPAC name is N'-hydroxy-2-(2-methoxyphenoxy)-6-methylpyrimidine-4-carboximidamide.
| Compound Name | N'-hydroxy-2-(2-methoxyphenoxy)-6-methylpyrimidine-4-carboximidamide |
|---|---|
| PubChem CID | 136907097 |
| Molecular Formula | C13H14N4O3 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | N'-hydroxy-2-(2-methoxyphenoxy)-6-methylpyrimidine-4-carboximidamide |
| SMILES | COc1ccccc1Oc1nc(C)cc(/C(N)=N/O)n1 |
| InChI | InChI=1S/C13H14N4O3/c1-8-7-9(12(14)17-18)16-13(15-8)20-11-6-4-3-5-10(11)19-2/h3-7,18H,1-2H3,(H2,14,17) |
| InChIKey | ZZQYTIRYWCPZDX-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 102.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|