C12H20N4O3 — CID 136907212
2-(2-butoxyethoxy)-N'-hydroxy-6-methylpyrimidine-4-carboximidamide (PubChem CID 136907212) has the molecular formula C12H20N4O3 and a molecular weight of 268.32 g/mol. Its IUPAC name is 2-(2-butoxyethoxy)-N'-hydroxy-6-methylpyrimidine-4-carboximidamide.
| Compound Name | 2-(2-butoxyethoxy)-N'-hydroxy-6-methylpyrimidine-4-carboximidamide |
|---|---|
| PubChem CID | 136907212 |
| Molecular Formula | C12H20N4O3 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 2-(2-butoxyethoxy)-N'-hydroxy-6-methylpyrimidine-4-carboximidamide |
| SMILES | CCCCOCCOc1nc(C)cc(/C(N)=N/O)n1 |
| InChI | InChI=1S/C12H20N4O3/c1-3-4-5-18-6-7-19-12-14-9(2)8-10(15-12)11(13)16-17/h8,17H,3-7H2,1-2H3,(H2,13,16) |
| InChIKey | ZZZJNXVEWIWJHR-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 102.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|