C9H16N4 — CID 117192715
1-methyl-5-(pyrrolidin-1-ylmethyl)imidazol-2-amine (PubChem CID 117192715) has the molecular formula C9H16N4 and a molecular weight of 180.25 g/mol. Its IUPAC name is 1-methyl-5-(pyrrolidin-1-ylmethyl)imidazol-2-amine.
| Compound Name | 1-methyl-5-(pyrrolidin-1-ylmethyl)imidazol-2-amine |
|---|---|
| PubChem CID | 117192715 |
| Molecular Formula | C9H16N4 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | 1-methyl-5-(pyrrolidin-1-ylmethyl)imidazol-2-amine |
| SMILES | Cn1c(CN2CCCC2)cnc1N |
| InChI | InChI=1S/C9H16N4/c1-12-8(6-11-9(12)10)7-13-4-2-3-5-13/h6H,2-5,7H2,1H3,(H2,10,11) |
| InChIKey | PHQFCYZUMYBVFL-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |