C13H17NO2 — CID 117194095
2-[3-(aminomethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]phenol (PubChem CID 117194095) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is 2-[3-(aminomethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]phenol.
| Compound Name | 2-[3-(aminomethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]phenol |
|---|---|
| PubChem CID | 117194095 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 2-[3-(aminomethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]phenol |
| SMILES | NCC1C2CCC(O2)C1c1ccccc1O |
| InChI | InChI=1S/C13H17NO2/c14-7-9-11-5-6-12(16-11)13(9)8-3-1-2-4-10(8)15/h1-4,9,11-13,15H,5-7,14H2 |
| InChIKey | GLASCYZUZNQSTA-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |