About [3-(aminomethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methanamine;platinum(2+);dichloride
[3-(aminomethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methanamine;platinum(2+);dichloride (PubChem CID 45273960) has the molecular formula C8H16Cl2N2OPt
and a molecular weight of 422.21 g/mol. Its IUPAC name is [3-(aminomethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methanamine;platinum(2+);dichloride.
Molecular Properties
| Compound Name | [3-(aminomethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methanamine;platinum(2+);dichloride |
| PubChem CID | 45273960 |
| Molecular Formula | C8H16Cl2N2OPt |
| Molecular Weight | 422.21 g/mol |
| Exact Mass | 421.03 |
| IUPAC Name | [3-(aminomethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methanamine;platinum(2+);dichloride |
| SMILES | NCC1C2CCC(O2)C1CN.[Cl-].[Cl-].[Pt+2] |
| InChI | InChI=1S/C8H16N2O.2ClH.Pt/c9-3-5-6(4-10)8-2-1-7(5)11-8;;;/h5-8H,1-4,9-10H2;2*1H;/q;;;+2/p-2 |
| InChIKey | PZXZHJWTDIKZGS-UHFFFAOYSA-L |
| XLogP | -6.30 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.21 |
| LogP ≤ 5 | -6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [3-(aminomethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methanamine;platinum(2+);dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(aminomethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methanamine;platinum(2+);dichloride?
The IUPAC name of [3-(aminomethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methanamine;platinum(2+);dichloride (CID 45273960) is [3-(aminomethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methanamine;platinum(2+);dichloride.
What is the SMILES notation for [3-(aminomethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methanamine;platinum(2+);dichloride?
The canonical SMILES for [3-(aminomethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methanamine;platinum(2+);dichloride is NCC1C2CCC(O2)C1CN.[Cl-].[Cl-].[Pt+2].
What is the InChIKey of [3-(aminomethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methanamine;platinum(2+);dichloride?
The InChIKey is PZXZHJWTDIKZGS-UHFFFAOYSA-L. The full InChI is InChI=1S/C8H16N2O.2ClH.Pt/c9-3-5-6(4-10)8-2-1-7(5)11-8;;;/h5-8H,1-4,9-10H2;2*1H;/q;;;+2/p-2.
What are the key properties of [3-(aminomethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methanamine;platinum(2+);dichloride?
[3-(aminomethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methanamine;platinum(2+);dichloride has a molecular weight of 422.21 g/mol, XLogP of -6.30, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(aminomethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methanamine;platinum(2+);dichloride is sourced from PubChem (CID 45273960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).