About [(1R,5R,6S)-2-oxabicyclo[3.1.0]hexan-6-yl]methanamine
[(1R,5R,6S)-2-oxabicyclo[3.1.0]hexan-6-yl]methanamine (PubChem CID 124555816) has the molecular formula C6H11NO
and a molecular weight of 113.16 g/mol. Its IUPAC name is [(1R,5R,6S)-2-oxabicyclo[3.1.0]hexan-6-yl]methanamine.
Analyze [(1R,5R,6S)-2-oxabicyclo[3.1.0]hexan-6-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,5R,6S)-2-oxabicyclo[3.1.0]hexan-6-yl]methanamine?
The IUPAC name of [(1R,5R,6S)-2-oxabicyclo[3.1.0]hexan-6-yl]methanamine (CID 124555816) is [(1R,5R,6S)-2-oxabicyclo[3.1.0]hexan-6-yl]methanamine.
What is the SMILES notation for [(1R,5R,6S)-2-oxabicyclo[3.1.0]hexan-6-yl]methanamine?
The canonical SMILES for [(1R,5R,6S)-2-oxabicyclo[3.1.0]hexan-6-yl]methanamine is NC[C@@H]1[C@H]2CCO[C@@H]12.
What is the InChIKey of [(1R,5R,6S)-2-oxabicyclo[3.1.0]hexan-6-yl]methanamine?
The InChIKey is AECSHWNFEPPOOE-HSUXUTPPSA-N. The full InChI is InChI=1S/C6H11NO/c7-3-5-4-1-2-8-6(4)5/h4-6H,1-3,7H2/t4-,5-,6-/m1/s1.
What are the key properties of [(1R,5R,6S)-2-oxabicyclo[3.1.0]hexan-6-yl]methanamine?
[(1R,5R,6S)-2-oxabicyclo[3.1.0]hexan-6-yl]methanamine has a molecular weight of 113.16 g/mol, XLogP of -0.02, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,5R,6S)-2-oxabicyclo[3.1.0]hexan-6-yl]methanamine is sourced from PubChem (CID 124555816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).