C6H11NO — CID 59234196
[(1R,5R)-2-oxabicyclo[3.1.0]hexan-6-yl]methanamine (PubChem CID 59234196) has the molecular formula C6H11NO and a molecular weight of 113.16 g/mol. Its IUPAC name is [(1R,5R)-2-oxabicyclo[3.1.0]hexan-6-yl]methanamine.
| Compound Name | [(1R,5R)-2-oxabicyclo[3.1.0]hexan-6-yl]methanamine |
|---|---|
| PubChem CID | 59234196 |
| Molecular Formula | C6H11NO |
| Molecular Weight | 113.16 g/mol |
| Exact Mass | 113.08 |
| IUPAC Name | [(1R,5R)-2-oxabicyclo[3.1.0]hexan-6-yl]methanamine |
| SMILES | NCC1[C@H]2CCO[C@@H]12 |
| InChI | InChI=1S/C6H11NO/c7-3-5-4-1-2-8-6(4)5/h4-6H,1-3,7H2/t4-,5?,6-/m1/s1 |
| InChIKey | AECSHWNFEPPOOE-SPWIIUKKSA-N |
| XLogP | -0.02 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.16 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |