C18H12BrN5O5 — CID 11719515
N-[[4-(5-bromopyrimidin-2-yl)oxyphenyl]carbamoyl]-2-nitrobenzamide (PubChem CID 11719515) has the molecular formula C18H12BrN5O5 and a molecular weight of 458.23 g/mol. Its IUPAC name is N-[[4-(5-bromopyrimidin-2-yl)oxyphenyl]carbamoyl]-2-nitrobenzamide.
| Compound Name | N-[[4-(5-bromopyrimidin-2-yl)oxyphenyl]carbamoyl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 11719515 |
| Molecular Formula | C18H12BrN5O5 |
| Molecular Weight | 458.23 g/mol |
| Exact Mass | 457.00 |
| IUPAC Name | N-[[4-(5-bromopyrimidin-2-yl)oxyphenyl]carbamoyl]-2-nitrobenzamide |
| SMILES | O=C(NC(=O)c1ccccc1[N+](=O)[O-])Nc1ccc(Oc2ncc(Br)cn2)cc1 |
| InChI | InChI=1S/C18H12BrN5O5/c19-11-9-20-18(21-10-11)29-13-7-5-12(6-8-13)22-17(26)23-16(25)14-3-1-2-4-15(14)24(27)28/h1-10H,(H2,22,23,25,26) |
| InChIKey | DBZDJFZSRGZROL-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 136.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.23 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|