C28H27N7O5 — CID 122633854
N-[5-[(3-methoxybenzoyl)amino]-2-methylphenyl]-4-(methylamino)-2-(4-methyl-3-nitroanilino)pyrimidine-5-carboxamide (PubChem CID 122633854) has the molecular formula C28H27N7O5 and a molecular weight of 541.57 g/mol. Its IUPAC name is N-[5-[(3-methoxybenzoyl)amino]-2-methylphenyl]-4-(methylamino)-2-(4-methyl-3-nitroanilino)pyrimidine-5-carboxamide.
| Compound Name | N-[5-[(3-methoxybenzoyl)amino]-2-methylphenyl]-4-(methylamino)-2-(4-methyl-3-nitroanilino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 122633854 |
| Molecular Formula | C28H27N7O5 |
| Molecular Weight | 541.57 g/mol |
| Exact Mass | 541.21 |
| IUPAC Name | N-[5-[(3-methoxybenzoyl)amino]-2-methylphenyl]-4-(methylamino)-2-(4-methyl-3-nitroanilino)pyrimidine-5-carboxamide |
| SMILES | CNc1nc(Nc2ccc(C)c([N+](=O)[O-])c2)ncc1C(=O)Nc1cc(NC(=O)c2cccc(OC)c2)ccc1C |
| InChI | InChI=1S/C28H27N7O5/c1-16-8-10-19(31-26(36)18-6-5-7-21(12-18)40-4)13-23(16)33-27(37)22-15-30-28(34-25(22)29-3)32-20-11-9-17(2)24(14-20)35(38)39/h5-15H,1-4H3,(H,31,36)(H,33,37)(H2,29,30,32,34) |
| InChIKey | BPTQBIXLWRQVPY-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 160.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.57 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|