C23H26N6O2 — CID 11974955
[4-amino-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-5-yl]-(3-methoxyphenyl)methanone (PubChem CID 11974955) has the molecular formula C23H26N6O2 and a molecular weight of 418.50 g/mol. Its IUPAC name is [4-amino-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-5-yl]-(3-methoxyphenyl)methanone.
| Compound Name | [4-amino-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-5-yl]-(3-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 11974955 |
| Molecular Formula | C23H26N6O2 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | [4-amino-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-5-yl]-(3-methoxyphenyl)methanone |
| SMILES | COc1cccc(C(=O)c2cnc(Nc3ccc(N4CCN(C)CC4)cc3)nc2N)c1 |
| InChI | InChI=1S/C23H26N6O2/c1-28-10-12-29(13-11-28)18-8-6-17(7-9-18)26-23-25-15-20(22(24)27-23)21(30)16-4-3-5-19(14-16)31-2/h3-9,14-15H,10-13H2,1-2H3,(H3,24,25,26,27) |
| InChIKey | WOGHTJWSWWAHPL-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|