C14H17F3N2 — CID 117196600
2-[1-ethyl-7-(trifluoromethyl)indol-2-yl]-N-methylethanamine (PubChem CID 117196600) has the molecular formula C14H17F3N2 and a molecular weight of 270.30 g/mol. Its IUPAC name is 2-[1-ethyl-7-(trifluoromethyl)indol-2-yl]-N-methylethanamine.
| Compound Name | 2-[1-ethyl-7-(trifluoromethyl)indol-2-yl]-N-methylethanamine |
|---|---|
| PubChem CID | 117196600 |
| Molecular Formula | C14H17F3N2 |
| Molecular Weight | 270.30 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | 2-[1-ethyl-7-(trifluoromethyl)indol-2-yl]-N-methylethanamine |
| SMILES | CCn1c(CCNC)cc2cccc(C(F)(F)F)c21 |
| InChI | InChI=1S/C14H17F3N2/c1-3-19-11(7-8-18-2)9-10-5-4-6-12(13(10)19)14(15,16)17/h4-6,9,18H,3,7-8H2,1-2H3 |
| InChIKey | ADQQUJZQXGPHJJ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.30 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |