C15H19F3N2 — CID 117196602
1-[1-ethyl-7-(trifluoromethyl)indol-2-yl]-N-methylpropan-2-amine (PubChem CID 117196602) has the molecular formula C15H19F3N2 and a molecular weight of 284.33 g/mol. Its IUPAC name is 1-[1-ethyl-7-(trifluoromethyl)indol-2-yl]-N-methylpropan-2-amine.
| Compound Name | 1-[1-ethyl-7-(trifluoromethyl)indol-2-yl]-N-methylpropan-2-amine |
|---|---|
| PubChem CID | 117196602 |
| Molecular Formula | C15H19F3N2 |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 1-[1-ethyl-7-(trifluoromethyl)indol-2-yl]-N-methylpropan-2-amine |
| SMILES | CCn1c(CC(C)NC)cc2cccc(C(F)(F)F)c21 |
| InChI | InChI=1S/C15H19F3N2/c1-4-20-12(8-10(2)19-3)9-11-6-5-7-13(14(11)20)15(16,17)18/h5-7,9-10,19H,4,8H2,1-3H3 |
| InChIKey | PXBNRSVZHRVIKU-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |