3-(4-fluoro-2,3-dihydro-1H-indol-2-yl)-2-methylpropanoic acid

C12H14FNO2 — CID 117198716

IUPAC3-(4-fluoro-2,3-dihydro-1H-indol-2-yl)-2-methylpropanoic acid
SMILESCC(CC1Cc2c(F)cccc2N1)C(=O)O
InChIInChI=1S/C12H14FNO2/c1-7(12(15)16)5-8-6-9-10(13)3-2-4-11(9)14-8/h2-4,7-8,14H,5-6H2,1H3,(H,15,16)
InChIKeyPEGYQAJJBVBMRQ-UHFFFAOYSA-N
MW223.25 g/mol
LogP2.27
Rot. Bonds3

About 3-(4-fluoro-2,3-dihydro-1H-indol-2-yl)-2-methylpropanoic acid

3-(4-fluoro-2,3-dihydro-1H-indol-2-yl)-2-methylpropanoic acid (PubChem CID 117198716) has the molecular formula C12H14FNO2 and a molecular weight of 223.25 g/mol. Its IUPAC name is 3-(4-fluoro-2,3-dihydro-1H-indol-2-yl)-2-methylpropanoic acid.

Molecular Properties

Compound Name3-(4-fluoro-2,3-dihydro-1H-indol-2-yl)-2-methylpropanoic acid
PubChem CID117198716
Molecular FormulaC12H14FNO2
Molecular Weight223.25 g/mol
Exact Mass223.10
IUPAC Name3-(4-fluoro-2,3-dihydro-1H-indol-2-yl)-2-methylpropanoic acid
SMILESCC(CC1Cc2c(F)cccc2N1)C(=O)O
InChIInChI=1S/C12H14FNO2/c1-7(12(15)16)5-8-6-9-10(13)3-2-4-11(9)14-8/h2-4,7-8,14H,5-6H2,1H3,(H,15,16)
InChIKeyPEGYQAJJBVBMRQ-UHFFFAOYSA-N
XLogP2.27
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500223.25
LogP ≤ 52.27
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 3-(4-fluoro-2,3-dihydro-1H-indol-2-yl)-2-methylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(4-fluoro-2,3-dihydro-1H-indol-2-yl)-2-methylpropanoic acid?
The IUPAC name of 3-(4-fluoro-2,3-dihydro-1H-indol-2-yl)-2-methylpropanoic acid (CID 117198716) is 3-(4-fluoro-2,3-dihydro-1H-indol-2-yl)-2-methylpropanoic acid.
What is the SMILES notation for 3-(4-fluoro-2,3-dihydro-1H-indol-2-yl)-2-methylpropanoic acid?
The canonical SMILES for 3-(4-fluoro-2,3-dihydro-1H-indol-2-yl)-2-methylpropanoic acid is CC(CC1Cc2c(F)cccc2N1)C(=O)O.
What is the InChIKey of 3-(4-fluoro-2,3-dihydro-1H-indol-2-yl)-2-methylpropanoic acid?
The InChIKey is PEGYQAJJBVBMRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14FNO2/c1-7(12(15)16)5-8-6-9-10(13)3-2-4-11(9)14-8/h2-4,7-8,14H,5-6H2,1H3,(H,15,16).
What are the key properties of 3-(4-fluoro-2,3-dihydro-1H-indol-2-yl)-2-methylpropanoic acid?
3-(4-fluoro-2,3-dihydro-1H-indol-2-yl)-2-methylpropanoic acid has a molecular weight of 223.25 g/mol, XLogP of 2.27, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-fluoro-2,3-dihydro-1H-indol-2-yl)-2-methylpropanoic acid is sourced from PubChem (CID 117198716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).