C27H36ClNO3Si — CID 11720047
(2R,3R)-3-(4-chlorophenyl)-2-[cyclohexyl(dimethyl)silyl]-4-(4-methoxyphenyl)-N,N-dimethyl-4-oxobutanamide (PubChem CID 11720047) has the molecular formula C27H36ClNO3Si and a molecular weight of 486.13 g/mol. Its IUPAC name is (2R,3R)-3-(4-chlorophenyl)-2-[cyclohexyl(dimethyl)silyl]-4-(4-methoxyphenyl)-N,N-dimethyl-4-oxobutanamide.
| Compound Name | (2R,3R)-3-(4-chlorophenyl)-2-[cyclohexyl(dimethyl)silyl]-4-(4-methoxyphenyl)-N,N-dimethyl-4-oxobutanamide |
|---|---|
| PubChem CID | 11720047 |
| Molecular Formula | C27H36ClNO3Si |
| Molecular Weight | 486.13 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | (2R,3R)-3-(4-chlorophenyl)-2-[cyclohexyl(dimethyl)silyl]-4-(4-methoxyphenyl)-N,N-dimethyl-4-oxobutanamide |
| SMILES | COc1ccc(C(=O)[C@@H](c2ccc(Cl)cc2)[C@H](C(=O)N(C)C)[Si](C)(C)C2CCCCC2)cc1 |
| InChI | InChI=1S/C27H36ClNO3Si/c1-29(2)27(31)26(33(4,5)23-9-7-6-8-10-23)24(19-11-15-21(28)16-12-19)25(30)20-13-17-22(32-3)18-14-20/h11-18,23-24,26H,6-10H2,1-5H3/t24-,26-/m1/s1 |
| InChIKey | CTKXLKCTEGLIOP-AOYPEHQESA-N |
| XLogP | 6.82 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.13 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|