C13H19NO2 — CID 117201471
2-(1-ethyl-5-methoxy-2,3-dihydroindol-2-yl)ethanol (PubChem CID 117201471) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is 2-(1-ethyl-5-methoxy-2,3-dihydroindol-2-yl)ethanol.
| Compound Name | 2-(1-ethyl-5-methoxy-2,3-dihydroindol-2-yl)ethanol |
|---|---|
| PubChem CID | 117201471 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 2-(1-ethyl-5-methoxy-2,3-dihydroindol-2-yl)ethanol |
| SMILES | CCN1c2ccc(OC)cc2CC1CCO |
| InChI | InChI=1S/C13H19NO2/c1-3-14-11(6-7-15)8-10-9-12(16-2)4-5-13(10)14/h4-5,9,11,15H,3,6-8H2,1-2H3 |
| InChIKey | CSVUGTCHHNPKJZ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|