C10H14N2O — CID 154110611
5-methoxy-2-methyl-2,3-dihydroindol-1-amine (PubChem CID 154110611) has the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. Its IUPAC name is 5-methoxy-2-methyl-2,3-dihydroindol-1-amine.
| Compound Name | 5-methoxy-2-methyl-2,3-dihydroindol-1-amine |
|---|---|
| PubChem CID | 154110611 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 5-methoxy-2-methyl-2,3-dihydroindol-1-amine |
| SMILES | COc1ccc2c(c1)CC(C)N2N |
| InChI | InChI=1S/C10H14N2O/c1-7-5-8-6-9(13-2)3-4-10(8)12(7)11/h3-4,6-7H,5,11H2,1-2H3 |
| InChIKey | LOKLRNCSSZZXFP-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|