C13H20N2O — CID 40802818
2-[(2R,5R)-2,5-dimethylpyrrolidin-1-yl]-5-methoxyaniline (PubChem CID 40802818) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is 2-[(2R,5R)-2,5-dimethylpyrrolidin-1-yl]-5-methoxyaniline.
| Compound Name | 2-[(2R,5R)-2,5-dimethylpyrrolidin-1-yl]-5-methoxyaniline |
|---|---|
| PubChem CID | 40802818 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 2-[(2R,5R)-2,5-dimethylpyrrolidin-1-yl]-5-methoxyaniline |
| SMILES | COc1ccc(N2[C@H](C)CC[C@H]2C)c(N)c1 |
| InChI | InChI=1S/C13H20N2O/c1-9-4-5-10(2)15(9)13-7-6-11(16-3)8-12(13)14/h6-10H,4-5,14H2,1-3H3/t9-,10-/m1/s1 |
| InChIKey | JBSKFSZPSJOLHU-NXEZZACHSA-N |
| XLogP | 2.65 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|