C12H18N2O — CID 83833453
6-methoxy-N,1-dimethyl-3,4-dihydro-2H-quinolin-3-amine (PubChem CID 83833453) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is 6-methoxy-N,1-dimethyl-3,4-dihydro-2H-quinolin-3-amine.
| Compound Name | 6-methoxy-N,1-dimethyl-3,4-dihydro-2H-quinolin-3-amine |
|---|---|
| PubChem CID | 83833453 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 6-methoxy-N,1-dimethyl-3,4-dihydro-2H-quinolin-3-amine |
| SMILES | CNC1Cc2cc(OC)ccc2N(C)C1 |
| InChI | InChI=1S/C12H18N2O/c1-13-10-6-9-7-11(15-3)4-5-12(9)14(2)8-10/h4-5,7,10,13H,6,8H2,1-3H3 |
| InChIKey | CTIODGUJHIWRHE-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|