C11H9F3O3S — CID 117201594
2-[1,1-dioxo-5-(trifluoromethyl)-2,3-dihydro-1-benzothiophen-3-yl]acetaldehyde (PubChem CID 117201594) has the molecular formula C11H9F3O3S and a molecular weight of 278.25 g/mol. Its IUPAC name is 2-[1,1-dioxo-5-(trifluoromethyl)-2,3-dihydro-1-benzothiophen-3-yl]acetaldehyde.
| Compound Name | 2-[1,1-dioxo-5-(trifluoromethyl)-2,3-dihydro-1-benzothiophen-3-yl]acetaldehyde |
|---|---|
| PubChem CID | 117201594 |
| Molecular Formula | C11H9F3O3S |
| Molecular Weight | 278.25 g/mol |
| Exact Mass | 278.02 |
| IUPAC Name | 2-[1,1-dioxo-5-(trifluoromethyl)-2,3-dihydro-1-benzothiophen-3-yl]acetaldehyde |
| SMILES | O=CCC1CS(=O)(=O)c2ccc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C11H9F3O3S/c12-11(13,14)8-1-2-10-9(5-8)7(3-4-15)6-18(10,16)17/h1-2,4-5,7H,3,6H2 |
| InChIKey | MMNFIOJJGRKBCB-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.25 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|