C14H21NO2 — CID 117202563
1-(5-methoxy-1-propan-2-yl-2,3-dihydroindol-3-yl)ethanol (PubChem CID 117202563) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is 1-(5-methoxy-1-propan-2-yl-2,3-dihydroindol-3-yl)ethanol.
| Compound Name | 1-(5-methoxy-1-propan-2-yl-2,3-dihydroindol-3-yl)ethanol |
|---|---|
| PubChem CID | 117202563 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | 1-(5-methoxy-1-propan-2-yl-2,3-dihydroindol-3-yl)ethanol |
| SMILES | COc1ccc2c(c1)C(C(C)O)CN2C(C)C |
| InChI | InChI=1S/C14H21NO2/c1-9(2)15-8-13(10(3)16)12-7-11(17-4)5-6-14(12)15/h5-7,9-10,13,16H,8H2,1-4H3 |
| InChIKey | SAHTVTSYXHSWRI-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|