C11H13F3N2O — CID 117202728
O-[[1-methyl-6-(trifluoromethyl)-2,3-dihydroindol-2-yl]methyl]hydroxylamine (PubChem CID 117202728) has the molecular formula C11H13F3N2O and a molecular weight of 246.23 g/mol. Its IUPAC name is O-[[1-methyl-6-(trifluoromethyl)-2,3-dihydroindol-2-yl]methyl]hydroxylamine.
| Compound Name | O-[[1-methyl-6-(trifluoromethyl)-2,3-dihydroindol-2-yl]methyl]hydroxylamine |
|---|---|
| PubChem CID | 117202728 |
| Molecular Formula | C11H13F3N2O |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | O-[[1-methyl-6-(trifluoromethyl)-2,3-dihydroindol-2-yl]methyl]hydroxylamine |
| SMILES | CN1c2cc(C(F)(F)F)ccc2CC1CON |
| InChI | InChI=1S/C11H13F3N2O/c1-16-9(6-17-15)4-7-2-3-8(5-10(7)16)11(12,13)14/h2-3,5,9H,4,6,15H2,1H3 |
| InChIKey | SQSVWYPHVKEQFZ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|