C13H17NO — CID 117203522
2-(1-ethyl-2-methyl-2,3-dihydroindol-6-yl)acetaldehyde (PubChem CID 117203522) has the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. Its IUPAC name is 2-(1-ethyl-2-methyl-2,3-dihydroindol-6-yl)acetaldehyde.
| Compound Name | 2-(1-ethyl-2-methyl-2,3-dihydroindol-6-yl)acetaldehyde |
|---|---|
| PubChem CID | 117203522 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 2-(1-ethyl-2-methyl-2,3-dihydroindol-6-yl)acetaldehyde |
| SMILES | CCN1c2cc(CC=O)ccc2CC1C |
| InChI | InChI=1S/C13H17NO/c1-3-14-10(2)8-12-5-4-11(6-7-15)9-13(12)14/h4-5,7,9-10H,3,6,8H2,1-2H3 |
| InChIKey | BKRZNEKNRLYFHB-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|