C29H42N4O3 — CID 11720701
1-(cyclopropylmethyl)-8-[[(3S,4S)-1-(3,3-dimethylbutanoyl)-4-phenylpyrrolidin-3-yl]methyl]-3-methyl-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 11720701) has the molecular formula C29H42N4O3 and a molecular weight of 494.68 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-8-[[(3S,4S)-1-(3,3-dimethylbutanoyl)-4-phenylpyrrolidin-3-yl]methyl]-3-methyl-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 1-(cyclopropylmethyl)-8-[[(3S,4S)-1-(3,3-dimethylbutanoyl)-4-phenylpyrrolidin-3-yl]methyl]-3-methyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 11720701 |
| Molecular Formula | C29H42N4O3 |
| Molecular Weight | 494.68 g/mol |
| Exact Mass | 494.33 |
| IUPAC Name | 1-(cyclopropylmethyl)-8-[[(3S,4S)-1-(3,3-dimethylbutanoyl)-4-phenylpyrrolidin-3-yl]methyl]-3-methyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | CN1C(=O)N(CC2CC2)C2(CCN(C[C@H]3CN(C(=O)CC(C)(C)C)C[C@@H]3c3ccccc3)CC2)C1=O |
| InChI | InChI=1S/C29H42N4O3/c1-28(2,3)16-25(34)32-19-23(24(20-32)22-8-6-5-7-9-22)18-31-14-12-29(13-15-31)26(35)30(4)27(36)33(29)17-21-10-11-21/h5-9,21,23-24H,10-20H2,1-4H3/t23-,24+/m0/s1 |
| InChIKey | IKARTNNRWUWBCV-BJKOFHAPSA-N |
| XLogP | 3.80 |
| TPSA | 64.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.68 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|