C35H48N4O5S — CID 11686174
8-[[(3S,4S)-1-(3,3-dimethylbutanoyl)-4-phenylpyrrolidin-3-yl]methyl]-3-[(4-methylsulfonylphenyl)methyl]-1-propan-2-yl-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 11686174) has the molecular formula C35H48N4O5S and a molecular weight of 636.86 g/mol. Its IUPAC name is 8-[[(3S,4S)-1-(3,3-dimethylbutanoyl)-4-phenylpyrrolidin-3-yl]methyl]-3-[(4-methylsulfonylphenyl)methyl]-1-propan-2-yl-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-[[(3S,4S)-1-(3,3-dimethylbutanoyl)-4-phenylpyrrolidin-3-yl]methyl]-3-[(4-methylsulfonylphenyl)methyl]-1-propan-2-yl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 11686174 |
| Molecular Formula | C35H48N4O5S |
| Molecular Weight | 636.86 g/mol |
| Exact Mass | 636.33 |
| IUPAC Name | 8-[[(3S,4S)-1-(3,3-dimethylbutanoyl)-4-phenylpyrrolidin-3-yl]methyl]-3-[(4-methylsulfonylphenyl)methyl]-1-propan-2-yl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | CC(C)N1C(=O)N(Cc2ccc(S(C)(=O)=O)cc2)C(=O)C12CCN(C[C@H]1CN(C(=O)CC(C)(C)C)C[C@@H]1c1ccccc1)CC2 |
| InChI | InChI=1S/C35H48N4O5S/c1-25(2)39-33(42)38(21-26-12-14-29(15-13-26)45(6,43)44)32(41)35(39)16-18-36(19-17-35)22-28-23-37(31(40)20-34(3,4)5)24-30(28)27-10-8-7-9-11-27/h7-15,25,28,30H,16-24H2,1-6H3/t28-,30+/m0/s1 |
| InChIKey | CQKLIXKBMPAGGD-MFMCTBQISA-N |
| XLogP | 4.78 |
| TPSA | 98.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.86 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|