C33H41ClF2N4O5S — CID 11571123
8-[[(3S,4S)-1-(4,4-difluorocyclohexanecarbonyl)-4-phenylpyrrolidin-3-yl]methyl]-3-[(4-methylsulfonylphenyl)methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione;hydrochloride (PubChem CID 11571123) has the molecular formula C33H41ClF2N4O5S and a molecular weight of 679.23 g/mol. Its IUPAC name is 8-[[(3S,4S)-1-(4,4-difluorocyclohexanecarbonyl)-4-phenylpyrrolidin-3-yl]methyl]-3-[(4-methylsulfonylphenyl)methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione;hydrochloride.
| Compound Name | 8-[[(3S,4S)-1-(4,4-difluorocyclohexanecarbonyl)-4-phenylpyrrolidin-3-yl]methyl]-3-[(4-methylsulfonylphenyl)methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 11571123 |
| Molecular Formula | C33H41ClF2N4O5S |
| Molecular Weight | 679.23 g/mol |
| Exact Mass | 678.25 |
| IUPAC Name | 8-[[(3S,4S)-1-(4,4-difluorocyclohexanecarbonyl)-4-phenylpyrrolidin-3-yl]methyl]-3-[(4-methylsulfonylphenyl)methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione;hydrochloride |
| SMILES | CS(=O)(=O)c1ccc(CN2C(=O)NC3(CCN(C[C@H]4CN(C(=O)C5CCC(F)(F)CC5)C[C@@H]4c4ccccc4)CC3)C2=O)cc1.Cl |
| InChI | InChI=1S/C33H40F2N4O5S.ClH/c1-45(43,44)27-9-7-23(8-10-27)19-39-30(41)32(36-31(39)42)15-17-37(18-16-32)20-26-21-38(22-28(26)24-5-3-2-4-6-24)29(40)25-11-13-33(34,35)14-12-25;/h2-10,25-26,28H,11-22H2,1H3,(H,36,42);1H/t26-,28+;/m0./s1 |
| InChIKey | VFMCLMSOJIDHPM-DMCZFVKOSA-N |
| XLogP | 4.47 |
| TPSA | 107.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.23 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|