C33H44N4O4S — CID 11664528
8-[[(3S,4S)-1-(cyclohexylmethyl)-4-phenylpyrrolidin-3-yl]methyl]-3-[(4-methylsulfonylphenyl)methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 11664528) has the molecular formula C33H44N4O4S and a molecular weight of 592.81 g/mol. Its IUPAC name is 8-[[(3S,4S)-1-(cyclohexylmethyl)-4-phenylpyrrolidin-3-yl]methyl]-3-[(4-methylsulfonylphenyl)methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-[[(3S,4S)-1-(cyclohexylmethyl)-4-phenylpyrrolidin-3-yl]methyl]-3-[(4-methylsulfonylphenyl)methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 11664528 |
| Molecular Formula | C33H44N4O4S |
| Molecular Weight | 592.81 g/mol |
| Exact Mass | 592.31 |
| IUPAC Name | 8-[[(3S,4S)-1-(cyclohexylmethyl)-4-phenylpyrrolidin-3-yl]methyl]-3-[(4-methylsulfonylphenyl)methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | CS(=O)(=O)c1ccc(CN2C(=O)NC3(CCN(C[C@H]4CN(CC5CCCCC5)C[C@@H]4c4ccccc4)CC3)C2=O)cc1 |
| InChI | InChI=1S/C33H44N4O4S/c1-42(40,41)29-14-12-26(13-15-29)21-37-31(38)33(34-32(37)39)16-18-35(19-17-33)22-28-23-36(20-25-8-4-2-5-9-25)24-30(28)27-10-6-3-7-11-27/h3,6-7,10-15,25,28,30H,2,4-5,8-9,16-24H2,1H3,(H,34,39)/t28-,30+/m0/s1 |
| InChIKey | OUMWVIXYHBNEAK-MFMCTBQISA-N |
| XLogP | 4.27 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.81 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|