C12H13FN2OS — CID 117207085
6-fluoro-3-(thiolan-3-ylmethyl)-1H-benzimidazol-2-one (PubChem CID 117207085) has the molecular formula C12H13FN2OS and a molecular weight of 252.31 g/mol. Its IUPAC name is 6-fluoro-3-(thiolan-3-ylmethyl)-1H-benzimidazol-2-one.
| Compound Name | 6-fluoro-3-(thiolan-3-ylmethyl)-1H-benzimidazol-2-one |
|---|---|
| PubChem CID | 117207085 |
| Molecular Formula | C12H13FN2OS |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 6-fluoro-3-(thiolan-3-ylmethyl)-1H-benzimidazol-2-one |
| SMILES | O=c1[nH]c2cc(F)ccc2n1CC1CCSC1 |
| InChI | InChI=1S/C12H13FN2OS/c13-9-1-2-11-10(5-9)14-12(16)15(11)6-8-3-4-17-7-8/h1-2,5,8H,3-4,6-7H2,(H,14,16) |
| InChIKey | NCRMPFMXNHEIML-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |