C28H33Cl2FN4O2 — CID 11720912
N-cyclohexyl-1-(2,4-dichlorophenyl)-4-[(dimethylamino)methyl]-5-[4-(3-fluoropropoxy)phenyl]pyrazole-3-carboxamide (PubChem CID 11720912) has the molecular formula C28H33Cl2FN4O2 and a molecular weight of 547.50 g/mol. Its IUPAC name is N-cyclohexyl-1-(2,4-dichlorophenyl)-4-[(dimethylamino)methyl]-5-[4-(3-fluoropropoxy)phenyl]pyrazole-3-carboxamide.
| Compound Name | N-cyclohexyl-1-(2,4-dichlorophenyl)-4-[(dimethylamino)methyl]-5-[4-(3-fluoropropoxy)phenyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 11720912 |
| Molecular Formula | C28H33Cl2FN4O2 |
| Molecular Weight | 547.50 g/mol |
| Exact Mass | 546.20 |
| IUPAC Name | N-cyclohexyl-1-(2,4-dichlorophenyl)-4-[(dimethylamino)methyl]-5-[4-(3-fluoropropoxy)phenyl]pyrazole-3-carboxamide |
| SMILES | CN(C)Cc1c(C(=O)NC2CCCCC2)nn(-c2ccc(Cl)cc2Cl)c1-c1ccc(OCCCF)cc1 |
| InChI | InChI=1S/C28H33Cl2FN4O2/c1-34(2)18-23-26(28(36)32-21-7-4-3-5-8-21)33-35(25-14-11-20(29)17-24(25)30)27(23)19-9-12-22(13-10-19)37-16-6-15-31/h9-14,17,21H,3-8,15-16,18H2,1-2H3,(H,32,36) |
| InChIKey | QZUQBQOOMLKIEM-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.50 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|